Nome del prodotto |
2-Chloro-N-(2,6-diethylphenyl)-acetamide |
Sinonimi |
N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
Formula molecolare |
C12H16ClNO |
Peso Molecolare |
225.7145 |
InChI |
InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
Numero CAS |
6967-29-9 |
Struttura molecolare |
|
Densità |
1.131g/cm3 |
Punto di ebollizione |
369.2°C at 760 mmHg |
Indice di rifrazione |
1.559 |
Punto d'infiammabilità |
177.1°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|