Nome del prodotto |
4-bromophthalic acid |
Sinonimi |
4-Bromo-1,2-benzenedicarboxylic Acid; 4-bromobenzene-1,2-dicarboxylic acid; 4-bromobenzene-1,2-dicarboxylate |
Formula molecolare |
C8H3BrO4 |
Peso Molecolare |
243.0121 |
InChI |
InChI=1/C8H5BrO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13)/p-2 |
Numero CAS |
6968-28-1 |
EINECS |
230-183-4 |
Struttura molecolare |
|
Punto di ebollizione |
412.4°C at 760 mmHg |
Punto d'infiammabilità |
203.2°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|