Naam product |
6-Methoxysalicylaldehyde |
Synoniemen |
2-Hydroxy-6-methoxybenzaldehyde; 6-Hydroxy-o-anisaldehyde; 2-hydroxy-6-methoxy benzaldehyde |
MF |
C8H8O3 |
Molecuulgewicht |
152.1473 |
InChI |
InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
CAS-nummer |
700-44-7 |
EINECS |
211-844-6 |
Moleculaire Structuur |
|
Dichtheid |
1.231g/cm3 |
Kookpunt |
262.9°C at 760 mmHg |
Brekingsindex |
1.587 |
Vlampunt |
107.8°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|