نام محصول |
Ethyl 1,4-dihydro-8-fluoro-4-oxoquinoline-3-carboxylate |
مترادف |
Ethyl 8-fluoro-4-hydroxyquinoline-3-; Ethyl 8-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate; [chloro(fluoro)methyl]benzene |
میدان مغناطیسی |
C7H6ClF |
وزن مولکولی |
144.5739 |
InChI |
InChI=1/C7H6ClF/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
شماره سیایاس |
71083-06-2 |
ساختار مولکولی |
|
تراکم |
1.172g/cm3 |
نقطه ذوب |
217-219℃ |
نقطه غلیان |
166.1°C at 760 mmHg |
ضریب شکست |
1.498 |
نقطه اشتعال |
53.7°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|