Nama produk |
4-Acetamidocinnamic acid |
Sinonim |
(2E)-3-[4-(acetylamino)phenyl]prop-2-enoic acid |
MF |
C11H11NO3 |
Berat Molekul |
205.2099 |
InChI |
InChI=1/C11H11NO3/c1-8(13)12-10-5-2-9(3-6-10)4-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/b7-4+ |
CAS NO |
7152-04-7 |
Struktur Molekul |
|
Kepadatan |
1.297g/cm3 |
Titik didih |
470.9°C at 760 mmHg |
Indeks bias |
1.654 |
Titik nyala |
238.6°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|