product Name |
2,3-cycloheptenopyridine |
Molecular Formula |
C10H13N |
Molecular Weight |
147.2169 |
InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
CAS Registry Number |
7197-96-8 |
EINECS |
230-568-7 |
Molecular Structure |
|
Density |
0.999g/cm3 |
Boiling point |
224.9°C at 760 mmHg |
Refractive index |
1.533 |
Flash point |
93.3°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|