상품명칭 |
L-Valine |
별명 |
L-2-Amino-3-methylbutyric acid; L-Valine, FCC Grade L-2-Amino-3-methylbutyric acid, FCC Grade; H-Val-OH; 2-Amino-3-methylbutanoic acid; Lvaline; L-2-Aminoisovaleric acid; (S)-(+)-2-Amino-3-methylbutyric acid; ; 1-2-Amino-3-methylbutyric acid; Valine |
분자식 |
C5H11NO2 |
분자량 |
117.1478 |
InChI |
InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
cas번호 |
72-18-4;7004-03-7 |
EC번호 |
200-773-6 |
분자 구조 |
|
녹는 점 |
315℃ |
굴절 지수 |
1.507 |
물 용해도 |
85 g/L (20℃) |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|