Nome del prodotto |
Methyl 4-biphenylcarboxylate |
Sinonimi |
P-phenylbenzoic acid methyl ester; p-Phenylbenzoic acid-OMe; Methyl 4-Phenylbenzoate; 4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate; methyl biphenyl-4-carboxylate; methyl 4-phenylcyclohexanecarboxylate |
Formula molecolare |
C14H18O2 |
Peso Molecolare |
218.2915 |
InChI |
InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
Numero CAS |
720-75-2 |
EINECS |
211-954-4 |
Struttura molecolare |
|
Densità |
1.048g/cm3 |
Punto di fusione |
118℃ |
Punto di ebollizione |
307.8°C at 760 mmHg |
Indice di rifrazione |
1.517 |
Punto d'infiammabilità |
132.7°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|