상품명칭 |
2-Piperidinobenzonitrile |
별명 |
2-(1-Piperidino)benzonitrile; 2-piperidin-1-ylbenzonitrile |
분자식 |
C12H14N2 |
분자량 |
186.253 |
InChI |
InChI=1/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2 |
cas번호 |
72752-52-4 |
EC번호 |
427-330-1 |
분자 구조 |
|
밀도 |
1.09g/cm3 |
녹는 점 |
48-50℃ |
비등점 |
336.9°C at 760 mmHg |
굴절 지수 |
1.577 |
인화점 |
147.5°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|