نام محصول |
4,5-Dimethoxy-2-nitrophenylacetic acid |
مترادف |
2-(4,5-Dimethoxy-2-nitrophenyl)acetic acid; (4,5-dimethoxy-2-nitrophenyl)acetate |
میدان مغناطیسی |
C10H10NO6 |
وزن مولکولی |
240.19 |
InChI |
InChI=1/C10H11NO6/c1-16-8-3-6(4-10(12)13)7(11(14)15)5-9(8)17-2/h3,5H,4H2,1-2H3,(H,12,13)/p-1 |
شماره سیایاس |
73357-18-3 |
ساختار مولکولی |
|
نقطه ذوب |
206-208℃ |
نقطه غلیان |
433.4°C at 760 mmHg |
نقطه اشتعال |
215.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|