Nome del prodotto |
N-(2-Chloroethyl)acetamide |
Sinonimi |
Acetamide, N-(2-chloroethyl)-; 4-04-00-00449 (Beilstein Handbook Reference); AI3-08685; BRN 1743108; NSC 30247 |
Formula molecolare |
C4H8ClNO |
Peso Molecolare |
121.5654 |
InChI |
InChI=1/C4H8ClNO/c1-4(7)6-3-2-5/h2-3H2,1H3,(H,6,7) |
Numero CAS |
7355-58-0 |
EINECS |
230-884-5 |
Struttura molecolare |
|
Densità |
1.086g/cm3 |
Punto di ebollizione |
275.6°C at 760 mmHg |
Indice di rifrazione |
1.432 |
Punto d'infiammabilità |
120.4°C |
Simboli di pericolo |
Xn:Harmful;
|
Codici di Rischio |
R33:Danger of cummulative effects.;
|
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|