Naam product |
4,5-diiodo-2-methyl-1H-imidazole |
Synoniemen |
4,5-Diiodo-2-methylimidazole |
MF |
C4H4I2N2 |
Molecuulgewicht |
333.8969 |
InChI |
InChI=1/C4H4I2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8) |
CAS-nummer |
73746-44-8 |
Moleculaire Structuur |
|
Dichtheid |
2.75g/cm3 |
Smeltpunt |
194℃ |
Kookpunt |
434.9°C at 760 mmHg |
Brekingsindex |
1.749 |
Vlampunt |
216.8°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|