product Name |
3-Chloro-L-tyrosine |
Synonyms |
3-Chloro-4-hydroxy-L-phenylalanine~H-Tyr(3-Cl)-OH; 3-chlorotyrosine; H-Tyr(3-Cl)-OH |
Molecular Formula |
C9H10ClNO3 |
Molecular Weight |
215.6336 |
InChI |
InChI=1/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
CAS Registry Number |
7423-93-0 |
EINECS |
231-050-3 |
Molecular Structure |
|
Density |
1.458g/cm3 |
Melting point |
249℃ |
Boiling point |
388.6°C at 760 mmHg |
Refractive index |
1.625 |
Flash point |
188.8°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|