Ονομασία του προϊόντος |
2-(Methylthio)nicotinic acid |
Συνώνυμα |
2-(Methylmercapto)pyridine-3-carboxylic acid~2-(Methylthio)pyridine-3-carboxylic acid; 2-(Methylmercapto)-nicotinic acid; 2-(methylsulfanyl)pyridine-3-carboxylic acid; 2-(methylsulfanyl)pyridine-3-carboxylate |
MF |
C7H6NO2S |
Μοριακό βάρος |
168.1936 |
InChI |
InChI=1/C7H7NO2S/c1-11-6-5(7(9)10)3-2-4-8-6/h2-4H,1H3,(H,9,10)/p-1 |
CAS ΟΧΙ |
74470-23-8 |
Μοριακή δομή |
|
Σημείο τήξης |
214-218℃ |
Σημείο βρασμού |
329.6°C at 760 mmHg |
Σημείο ανάφλεξης |
153.2°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|