product Name |
methyl 3,5-dibromo-4-methylbenzoate |
Synonyms |
3,5-Dibromo-4-methylbenzoic acid methyl ester; 3,5-Dibromo-p-toluic acid methyl ester (COOCH3=1) |
Molecular Formula |
C9H8Br2O2 |
Molecular Weight |
307.9666 |
InChI |
InChI=1/C9H8Br2O2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2/h3-4H,1-2H3 |
CAS Registry Number |
74896-66-5 |
Molecular Structure |
|
Density |
1.75g/cm3 |
Boiling point |
314°C at 760 mmHg |
Refractive index |
1.575 |
Flash point |
143.7°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|