Naam product |
D-(+)-Histidinol dihydrochloride |
Synoniemen |
(R)-2-Amino-3-(4-imidazolyl)propanol dihydrochloride; D-histidinol dihydrochloride |
MF |
C6H13Cl2N3O |
Molecuulgewicht |
214.0929 |
InChI |
InChI=1/C6H11N3O.2ClH/c7-5(3-10)1-6-2-8-4-9-6;;/h2,4-5,10H,1,3,7H2,(H,8,9);2*1H/t5-;;/m1../s1 |
CAS-nummer |
75614-84-5 |
Moleculaire Structuur |
|
Smeltpunt |
198-200℃ |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|