product Name |
N,N-Dimethylthioformamide |
Synonyms |
NN-Dimethylthioformamide |
Molecular Formula |
C3H7NS |
Molecular Weight |
89.1594 |
InChI |
InChI=1/C3H7NS/c1-4(2)3-5/h3H,1-2H3 |
CAS Registry Number |
758-16-7 |
EINECS |
212-060-7 |
Molecular Structure |
|
Density |
0.985g/cm3 |
Boiling point |
224.9°C at 760 mmHg |
Refractive index |
1.511 |
Flash point |
89.8°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|