Naam product |
2,3-Dimethylmaleic anhydride |
Synoniemen |
3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione; 4,5-Dimethyl-1,3-Dioxa-2-Oxo-Cyclopentene |
MF |
C6H6O3 |
Molecuulgewicht |
126.11 |
InChI |
InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
CAS-nummer |
766-39-2 |
EINECS |
212-165-8 |
Moleculaire Structuur |
|
Dichtheid |
1.236g/cm3 |
Smeltpunt |
93-96℃ |
Kookpunt |
223°C at 760 mmHg |
Brekingsindex |
1.486 |
Vlampunt |
95.6°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|