product Name |
4-Chloro-3-methylbenzoic acid |
Synonyms |
3-Methyl -4-Chlorobenzoic acid; 3-methyl-4-chlorobenzoic acid; 4-CHLORO-M-TOLUIC ACID; 4-Chloro-3-toluic acid; 4-Chloro-3-Methyl |
Molecular Formula |
C8H7ClO2 |
Molecular Weight |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11) |
CAS Registry Number |
7697-29-2 |
Molecular Structure |
|
Density |
1.31g/cm3 |
Boiling point |
299°C at 760 mmHg |
Refractive index |
1.573 |
Flash point |
134.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|