product Name |
Pyrithyldione |
Synonyms |
3,3-Diethyl-2,4(1H,3H)-pyridinedione; 3,3-diethylpyridine-2,4(1H,3H)-dione |
Molecular Formula |
C9H13NO2 |
Molecular Weight |
167.205 |
InChI |
InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
CAS Registry Number |
77-04-3 |
EINECS |
201-000-5 |
Molecular Structure |
|
Density |
1.029g/cm3 |
Boiling point |
330.2°C at 760 mmHg |
Refractive index |
1.464 |
Flash point |
147.8°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|