product Name |
2,3-Diaminonaphthalene |
Synonyms |
2,3-Naphthalenediamine; naphthalene-2,3-diamine |
Molecular Formula |
C10H10N2 |
Molecular Weight |
158.1998 |
InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
CAS Registry Number |
771-97-1 |
EINECS |
212-241-0 |
Molecular Structure |
|
Density |
1.234g/cm3 |
Melting point |
193-199℃ |
Boiling point |
370.6°C at 760 mmHg |
Refractive index |
1.757 |
Flash point |
212.3°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|