produktnavn |
Ethyl 4-amino-2-mercaptopyrimidine-5-carboxylate |
Synonymer |
4-Amino-2-mercaptopyrimidine-5-carboxylic acid ethyl ester; ethyl 6-amino-2-thioxo-1,2-dihydropyrimidine-5-carboxylate |
Molekylær Formel |
C7H9N3O2S |
Molekylvekt |
199.2303 |
InChI |
InChI=1/C7H9N3O2S/c1-2-12-6(11)4-3-9-7(13)10-5(4)8/h3H,2H2,1H3,(H3,8,9,10,13) |
CAS-nummer |
774-07-2 |
Molecular Structure |
|
Tetthet |
1.48g/cm3 |
Smeltepunkt |
261℃ |
Kokepunkt |
329.7°C at 760 mmHg |
Brytningsindeks |
1.659 |
Flammepunktet |
153.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|