Nazwa produktu: |
4-Nitrophenyl chloroacetate |
Synonimy |
AI3-23373; Acetic acid, chloro-, 4-nitrophenyl ester |
MF |
C8H6ClNO4 |
Masie cząsteczkowej |
215.5905 |
InChI |
InChI=1/C8H6ClNO4/c9-5-8(11)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2 |
Nr CAS |
777-84-4;79328-69-1 |
Struktury molekularnej |
|
Gęstość |
1.434g/cm3 |
Temperatura topnienia |
73-75℃ |
Temperatura wrzenia |
334.5°C at 760 mmHg |
Współczynnik załamania |
1.565 |
Temperatura zapłonu |
156.1°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|