שם המוצר |
(4-bromo-2-thienyl)methanol |
נרדפות |
(4-bromothiophen-2-yl)methanol; (4-Bromothien-2-yl)methanol |
מולקולרית פורמולה |
C5H5BrOS |
משקל מולקולרי |
193.0616 |
InChI |
InChI=1/C5H5BrOS/c6-4-1-5(2-7)8-3-4/h1,3,7H,2H2 |
מספר CAS |
79757-77-0 |
מבנה מולקולרי |
|
צפיפות |
1.773g/cm3 |
נקודת רתיחה |
271.491°C at 760 mmHg |
משקל סגולי |
1.631 |
נקודת הבזק |
117.994°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|