Nama produk |
5-Bromo-7-nitroindoline |
Sinonim |
5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
MF |
C8H7BrN2O2 |
Berat Molekul |
243.0574 |
InChI |
InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
CAS NO |
80166-90-1 |
EINECS |
279-411-4 |
Struktur Molekul |
|
Kepadatan |
1.704g/cm3 |
Titik didih |
344.2°C at 760 mmHg |
Indeks bias |
1.64 |
Titik nyala |
162°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|