product Name |
2-Phenylpropyl butyrate |
Synonyms |
Butanoic acid, 2-phenylpropyl ester; FEMA No. 2891; Hydratropyl butyrate; Methylphenethyl butyrate, beta-; 2-phenylpropyl butanoate; (2S)-2-phenylpropyl butanoate; (2R)-2-phenylpropyl butanoate; 2-Phenyl-1-propyl butyrate |
Molecular Formula |
C13H18O2 |
Molecular Weight |
206.2808 |
InChI |
InChI=1/C13H18O2/c1-3-7-13(14)15-10-11(2)12-8-5-4-6-9-12/h4-6,8-9,11H,3,7,10H2,1-2H3/t11-/m0/s1 |
CAS Registry Number |
80866-83-7 |
EINECS |
279-587-2 |
Molecular Structure |
|
Density |
0.986g/cm3 |
Boiling point |
276.8°C at 760 mmHg |
Refractive index |
1.493 |
Flash point |
104.6°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|