Nama produk |
4-Dimethylamino-3,5-dinitrobenzoic acid |
Sinonim |
4-(dimethylamino)-3,5-dinitrobenzoate |
MF |
C9H8N3O6 |
Berat Molekul |
254.1769 |
InChI |
InChI=1/C9H9N3O6/c1-10(2)8-6(11(15)16)3-5(9(13)14)4-7(8)12(17)18/h3-4H,1-2H3,(H,13,14)/p-1 |
CAS NO |
82366-55-0 |
Struktur Molekul |
|
Titik didih |
424.7°C at 760 mmHg |
Titik nyala |
210.6°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|