상품명칭 |
2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
별명 |
2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid; 5-Methyl-2-norbornene-5-carboxylic Acid; (1S,2S,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate; (1S,2R,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
분자식 |
C9H11O2 |
분자량 |
151.183 |
InChI |
InChI=1/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/p-1/t6-,7-,9-/m1/s1 |
cas번호 |
825-03-6 |
분자 구조 |
|
녹는 점 |
83℃ |
비등점 |
261.352°C at 760 mmHg |
인화점 |
121.096°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|