اسم المنتج |
(S)-3-Amino-3-phenylpropan-1-ol |
الاسم المستعار |
(S)-1-Phenyl-3-propanolamine; (S)-3-Amino-3-phenylpropi-1-ol; (S)-3-Amino-3-phenylpropan-l-ol; (3S)-3-amino-3-phenyl-propan-1-ol hydrochloride |
الصيغة الجزيئية |
C9H14ClNO |
الوزن الجزيئي الغرامي |
187.6666 |
InChI |
InChI=1/C9H13NO.ClH/c10-9(6-7-11)8-4-2-1-3-5-8;/h1-5,9,11H,6-7,10H2;1H/t9-;/m0./s1 |
إستراتيجية المساعدة القطرية |
82769-76-4 |
بنية جزيئية |
|
نقطة الغليان |
325.3°C at 760 mmHg |
نقطة الوميض |
150.5°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|