product Name |
N-Acetyl-L-tyrosine ethyl ester |
Synonyms |
ATEE; ethyl N-acetyl-L-tyrosinate; Ac-Tyr-OEt; ethyl N-acetyltyrosinate; ethyl N-acetyl-D-tyrosinate; (2S)-2-Acetamido-3-(4-Hydroxyphenyl)Propanoic Acid Ethyl Ester; (2S)-2-Acetamido-3-(4-Hydroxyphenyl)Propionic Acid Ethyl Ester; Ac-Tyr-Oet; Ac-Tyr.Oet |
Molecular Formula |
C13H17NO4 |
Molecular Weight |
251.2784 |
InChI |
InChI=1/C13H17NO4/c1-3-18-13(17)12(14-9(2)15)8-10-4-6-11(16)7-5-10/h4-7,12,16H,3,8H2,1-2H3,(H,14,15)/t12-/m1/s1 |
CAS Registry Number |
840-97-1 |
EINECS |
212-663-5 |
Molecular Structure |
|
Density |
1.179g/cm3 |
Melting point |
80-81℃ |
Boiling point |
464.4°C at 760 mmHg |
Refractive index |
1.533 |
Flash point |
234.7°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|