termék neve |
2-(1-Piperazinyl)-3-pyridinecarbonitrile |
Szinonimák |
1-(2-(3-Cyanopyridil))-piperazine; 2-Piperazinonicotinonitrile; 2-piperazin-1-ylpyridine-3-carbonitrile |
MF |
C10H12N4 |
Molekulatömeg |
188.2291 |
InChI |
InChI=1/C10H12N4/c11-8-9-2-1-3-13-10(9)14-6-4-12-5-7-14/h1-3,12H,4-7H2 |
CAS-szám |
84951-44-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.22g/cm3 |
Forráspont |
388°C at 760 mmHg |
Törésmutató |
1.605 |
Gyulladáspont |
188.4°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|