Nome do produto |
1-Hexyl-3-methylimidazolium bromide |
Sinônimos |
1-hexyl-3-methyl-1H-imidazol-3-ium bromide; 1-hexyl-3-methylimidazolium brimide |
Fórmula molecular |
C10H19BrN2 |
Peso Molecular |
247.1753 |
InChI |
InChI=1/C10H19N2.BrH/c1-3-4-5-6-7-12-9-8-11(2)10-12;/h8-10H,3-7H2,1-2H3;1H/q+1;/p-1 |
CAS Registry Number |
85100-78-3 |
Estrutura Molecular |
|
Símbolos de perigo |
Xi:Irritant;
|
Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|