Nome del prodotto |
Decafluorobenzophenone |
Formula molecolare |
C13F10O |
Peso Molecolare |
362.12 |
InChI |
InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
Numero CAS |
853-39-4 |
EINECS |
212-717-8 |
Struttura molecolare |
|
Punto di fusione |
92-94℃ |
Simboli di pericolo |
Xi:Irritant;
|
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|