produktnavn |
3',5-Dihydroxy-4',6,7-trimethoxyflavone |
Synonymer |
Eupatorin; 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7-dimethoxy-4H-chromen-4-one |
Molekylær Formel |
C18H16O7 |
Molekylvekt |
344.3154 |
InChI |
InChI=1/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
CAS-nummer |
855-96-9 |
Molecular Structure |
|
Tetthet |
1.387g/cm3 |
Kokepunkt |
587°C at 760 mmHg |
Brytningsindeks |
1.627 |
Flammepunktet |
216°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|