Nazwa produktu: |
Chloroform-d |
Synonimy |
Chloroform-d+1% TMs (v/v); chloroform-D 99.8 atom % D*contains 1% tms; Chloroformdisotopicpuritytetramethylsilane; Chloroform-d + 0.05% TMS (v/v); Chloroformdiosotopicpurity; Chloroform D1; trichloro(~2~H)methane |
MF |
CDCl3 |
Masie cząsteczkowej |
120.3838 |
InChI |
InChI=1/CHCl3/c2-1(3)4/h1H/i1D |
Nr CAS |
865-49-6 |
EINECS |
212-742-4 |
Struktury molekularnej |
|
Gęstość |
1.512g/cm3 |
Temperatura topnienia |
-64℃ |
Temperatura wrzenia |
61.2°C at 760 mmHg |
Współczynnik załamania |
1.445 |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R40:Possible risks of irreversible effects.;
R48/20/22:Harmful : danger of serious damage to health by prolonged exposure through inhalation and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|