نام محصول |
N,N'-Diacetylethylenediamine |
مترادف |
N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
میدان مغناطیسی |
C6H12N2O2 |
وزن مولکولی |
144.1717 |
InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
شماره سیایاس |
871-78-3 |
تعداد کمیسیون اروپایی |
212-811-9 |
ساختار مولکولی |
|
تراکم |
1.033g/cm3 |
نقطه غلیان |
438.7°C at 760 mmHg |
ضریب شکست |
1.444 |
نقطه اشتعال |
214.8°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|