produktnavn |
4'-Hydroxy-2'-methylacetophenone |
Synonymer |
2'-Methyl-4'-hydroxyacetophenone |
Molekylær Formel |
C9H10O2 |
Molekylvekt |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
CAS-nummer |
875-59-2 |
EINECS |
212-874-2 |
Molecular Structure |
|
Tetthet |
1.106g/cm3 |
Smeltepunkt |
127-132℃ |
Kokepunkt |
313°C at 760 mmHg |
Brytningsindeks |
1.546 |
Flammepunktet |
127.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|