상품명칭 |
(R)-1-(3-Methoxyphenyl)ethylamine |
별명 |
(R)-m-Methoxy-alpha-methylbenzylamine; (1R)-1-(3-methoxyphenyl)ethanamine |
분자식 |
C9H13NO |
분자량 |
151.2056 |
InChI |
InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m1/s1 |
cas번호 |
88196-70-7 |
분자 구조 |
|
밀도 |
1.003g/cm3 |
비등점 |
234.6°C at 760 mmHg |
굴절 지수 |
1.522 |
인화점 |
94.7°C |
리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|