produktnavn |
Diphenylcyclopropenone |
Synonymer |
Diphencyprone; 2,3-diphenylcycloprop-2-en-1-one; 1,2-Diphenylcycelopropen-3-One; 1,2-Diphenylcyclopropen-3-one |
Molekylær Formel |
C15H10O |
Molekylvekt |
206.2393 |
InChI |
InChI=1/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
CAS-nummer |
886-38-4 |
EINECS |
212-948-4 |
Molecular Structure |
|
Tetthet |
1.232g/cm3 |
Smeltepunkt |
119-121℃ |
Kokepunkt |
407.2°C at 760 mmHg |
Brytningsindeks |
1.668 |
Flammepunktet |
182.7°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R43:May cause sensitization by skin contact.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|