Poly(styrene)

نام محصول	Poly(styrene)
مترادف	Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene
میدان مغناطیسی	C₈H₈
وزن مولکولی	104.1491
InChI	InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H
شماره سیایاس	9003-53-6
ساختار مولکولی
تراکم	1.047
نقطه غلیان	212℃
ضریب شکست	1.5916
حلالیت آب	insoluble
خطر نمادها	Xi:;
کدهای خطر	41:;
توضیحات ایمنی	S24/25:;