Produkt-Name |
Poly(methyl methacrylate) |
Synonyme |
Methyl Methacrylate Resin (High M.Wt.); Methacrylic Acid Methyl Ester, Polymer n=13,500-14,000; PMMA; 2-Propenoic acid, 2-methyl-, methyl ester, homopolymer; Acryloid; Methyl methacrylate homopolymer; Methyl methacrylate, polymerized; Methyl methacrylate resin; Poly(methyl methacrylate), beads |
Molekulare Formel |
(C5H8O2)x |
Molecular Weight |
99.1083 |
InChI |
InChI=1/C5H7O2/c1-4(2)5(6)7-3/h1H,2-3H3 |
CAS Registry Number |
9011-14-7;9065-11-6 |
Molecular Structure |
|
Dichte |
1.18 |
Schmelzpunkt |
105℃ |
Brechungsindex |
1.49 |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|