termék neve |
(4-Cyanomethylphenyl)boronic acid |
Szinonimák |
4-(Cyanomethyl)benzeneboronic acid; 4-Boronophenylacetonitrile; 4-(Cyanomethyl)phenylboronic acid; [4-(cyanomethyl)phenyl]boronic acid |
MF |
C8H8BNO2 |
Molekulatömeg |
160.9656 |
InChI |
InChI=1/C8H8BNO2/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,11-12H,5H2 |
CAS-szám |
91983-26-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.2g/cm3 |
Forráspont |
375.7°C at 760 mmHg |
Törésmutató |
1.548 |
Gyulladáspont |
181°C |
Kockázatot kódok |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|