Nome del prodotto |
Hydrobenzamide |
Sinonimi |
N,N'-Dibenzylidenetoluene-alpha,alpha-diamine; NSC 1005; Methanediamine, 1-phenyl-N,N'-bis(phenylmethylene)-; Toluene-alpha,alpha-diamine, N,N'-dibenzylidene- (8CI); N,N'-dibenzylidene-1-phenylmethanediamine; 1-phenyl-N,N'-bis[(E)-phenylmethylidene]methanediamine |
Formula molecolare |
C21H18N2 |
Peso Molecolare |
298.381 |
InChI |
InChI=1/C21H18N2/c1-4-10-18(11-5-1)16-22-21(20-14-8-3-9-15-20)23-17-19-12-6-2-7-13-19/h1-17,21H/b22-16+,23-17+ |
Numero CAS |
92-29-5 |
EINECS |
202-144-1 |
Struttura molecolare |
|
Densità |
1.013g/cm3 |
Punto di ebollizione |
422.606°C at 760 mmHg |
Indice di rifrazione |
1.578 |
Punto d'infiammabilità |
201.987°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|