Pyronin Y

उत्पाद का नाम	Pyronin Y
समानार्थी	C.I. 45005; Pyronine; Pyronin G; PYRONINE G; pyronin Y molecular biology; Pyronin Y, CI 45005; Pyronine Y; N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride
आणविक फार्मूला	C₁₇H₁₉ClN₂O
आण्विक वजन	302.7986
InChI	InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1
कैस रजिस्टी संख्या	92-32-0
EINECS	202-147-8
आणविक संरचना
गलनांक	250-260℃
खतरा प्रतीक	Xn:Harmful;
सुरक्षा विवरण	S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;