상품명칭 |
1-Phenyl-1-cyclopropanecarbonitrile |
별명 |
1-Phenylcyclopropanecarbonitrile |
분자식 |
C10H9N |
분자량 |
143.1852 |
InChI |
InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
cas번호 |
935-44-4 |
EC번호 |
213-304-5 |
분자 구조 |
|
밀도 |
1.09g/cm3 |
비등점 |
238.5°C at 760 mmHg |
굴절 지수 |
1.571 |
인화점 |
99°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|