Nama produk |
3-(trifluoromethyl)thiophenol |
Sinonim |
3-(Trifluoromethyl)benzenethiol; 1-bromo-5-chloro-2-fluoro-4-methylbenzene; 3-Trifluoromethyl thiophenol |
MF |
C7H5BrClF |
Berat Molekul |
223.47 |
InChI |
InChI=1/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3 |
CAS NO |
937-00-8 |
Struktur Molekul |
|
Kepadatan |
1.618g/cm3 |
Titik didih |
221.1°C at 760 mmHg |
Indeks bias |
1.545 |
Titik nyala |
87.5°C |
Kode Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|