Ürün Adı |
2-Bromo-3-chloropyridine |
Moleküler Formülü |
C5H3BrClN |
Molekül Ağırlığı |
192.441 |
InChI |
InChI=1/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H |
CAS kayıt numarası |
96424-68-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.736g/cm3 |
Kaynama noktası |
223.9°C at 760 mmHg |
Kırılma indisi |
1.581 |
Alevlenme noktası |
89.2°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|