product Name |
Benzo(b)furan-2-boronic acid |
Synonyms |
Benzofuran-2-boronic acid; Benzo[b]furan-2-boronic acid; 1-Benzofuran-2-ylboronic acid; Benzofuran-2-ylboronic acid |
Molecular Formula |
C8H7BO3 |
Molecular Weight |
161.9504 |
InChI |
InChI=1/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H |
CAS Registry Number |
98437-24-2 |
Molecular Structure |
|
Density |
1.31g/cm3 |
Melting point |
114-116℃ |
Boiling point |
340.4°C at 760 mmHg |
Refractive index |
1.618 |
Flash point |
159.7°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|