상품명칭 |
n-Tetradecylboronic acid |
별명 |
Myristylboronic acid~n-Tetradecaneboronic acid; tetradecylboronic acid |
분자식 |
C14H31BO2 |
분자량 |
242.2057 |
InChI |
InChI=1/C14H31BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h16-17H,2-14H2,1H3 |
cas번호 |
100888-40-2 |
분자 구조 |
|
밀도 |
0.875g/cm3 |
비등점 |
360.9°C at 760 mmHg |
굴절 지수 |
1.443 |
인화점 |
172.1°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|