اسم المنتج |
n-Tetradecylboronic acid |
الاسم المستعار |
Myristylboronic acid~n-Tetradecaneboronic acid; tetradecylboronic acid |
الصيغة الجزيئية |
C14H31BO2 |
الوزن الجزيئي الغرامي |
242.2057 |
InChI |
InChI=1/C14H31BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h16-17H,2-14H2,1H3 |
إستراتيجية المساعدة القطرية |
100888-40-2 |
بنية جزيئية |
|
كثافة |
0.875g/cm3 |
نقطة الغليان |
360.9°C at 760 mmHg |
معامل الإنكسار |
1.443 |
نقطة الوميض |
172.1°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|